C31H36F2N5O5PS — CID 71010509
ditert-butyl [(2R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl phosphate (PubChem CID 71010509) has the molecular formula C31H36F2N5O5PS and a molecular weight of 659.70 g/mol. Its IUPAC name is ditert-butyl [(2R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl phosphate.
| Compound Name | ditert-butyl [(2R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl phosphate |
|---|---|
| PubChem CID | 71010509 |
| Molecular Formula | C31H36F2N5O5PS |
| Molecular Weight | 659.70 g/mol |
| Exact Mass | 659.21 |
| IUPAC Name | ditert-butyl [(2R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl phosphate |
| SMILES | CC(c1nc(-c2ccc(C#N)cc2)cs1)[C@@](Cn1cncn1)(OCOP(=O)(OC(C)(C)C)OC(C)(C)C)c1ccc(F)cc1F |
| InChI | InChI=1S/C31H36F2N5O5PS/c1-21(28-37-27(16-45-28)23-10-8-22(15-34)9-11-23)31(17-38-19-35-18-36-38,25-13-12-24(32)14-26(25)33)40-20-41-44(39,42-29(2,3)4)43-30(5,6)7/h8-14,16,18-19,21H,17,20H2,1-7H3/t21?,31-/m1/s1 |
| InChIKey | XYIRIEAMRPBUKG-KOCNETHOSA-N |
| XLogP | 7.98 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.70 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|