C29H32F2N5O5PS — CID 53496379
[(2R,3R)-3-[4-(4-cyano(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl dipropan-2-yl phosphate (PubChem CID 53496379) has the molecular formula C29H32F2N5O5PS and a molecular weight of 637.60 g/mol. Its IUPAC name is [(2R,3R)-3-[4-(4-cyano(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl dipropan-2-yl phosphate.
| Compound Name | [(2R,3R)-3-[4-(4-cyano(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl dipropan-2-yl phosphate |
|---|---|
| PubChem CID | 53496379 |
| Molecular Formula | C29H32F2N5O5PS |
| Molecular Weight | 637.60 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | [(2R,3R)-3-[4-(4-cyano(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl dipropan-2-yl phosphate |
| SMILES | CC(C)OP(=O)(OCO[C@@](Cn1cncn1)(c1ccc(F)cc1F)[C@@H](C)c1nc(-[13c]2[13cH][13cH][13c](C#N)[13cH][13cH]2)cs1)OC(C)C |
| InChI | InChI=1S/C29H32F2N5O5PS/c1-19(2)40-42(37,41-20(3)4)39-18-38-29(15-36-17-33-16-34-36,25-11-10-24(30)12-26(25)31)21(5)28-35-27(14-43-28)23-8-6-22(13-32)7-9-23/h6-12,14,16-17,19-21H,15,18H2,1-5H3/t21-,29+/m0/s1/i6+1,7+1,8+1,9+1,22+1,23+1 |
| InChIKey | FDPWETHBSOYOEY-PEFLUMNFSA-N |
| XLogP | 7.20 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|