C31H27F2N5O3S — CID 59093746
[(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-methylbenzoate (PubChem CID 59093746) has the molecular formula C31H27F2N5O3S and a molecular weight of 587.65 g/mol. Its IUPAC name is [(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-methylbenzoate.
| Compound Name | [(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-methylbenzoate |
|---|---|
| PubChem CID | 59093746 |
| Molecular Formula | C31H27F2N5O3S |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | [(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-methylbenzoate |
| SMILES | C=Nc1ccc(-c2csc([C@H](C)C(Cn3cncn3)(OCOC(=O)c3cccc(C)c3)c3ccc(F)cc3F)n2)cc1 |
| InChI | InChI=1S/C31H27F2N5O3S/c1-20-5-4-6-23(13-20)30(39)40-19-41-31(16-38-18-35-17-36-38,26-12-9-24(32)14-27(26)33)21(2)29-37-28(15-42-29)22-7-10-25(34-3)11-8-22/h4-15,17-18,21H,3,16,19H2,1-2H3/t21-,31?/m0/s1 |
| InChIKey | ZCSGXBGKADBBBT-FEAGIOCNSA-N |
| XLogP | 6.85 |
| TPSA | 91.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|