C36H37F2N5O3S — CID 59975558
[(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-(2-ethylbutyl)benzoate (PubChem CID 59975558) has the molecular formula C36H37F2N5O3S and a molecular weight of 657.79 g/mol. Its IUPAC name is [(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-(2-ethylbutyl)benzoate.
| Compound Name | [(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-(2-ethylbutyl)benzoate |
|---|---|
| PubChem CID | 59975558 |
| Molecular Formula | C36H37F2N5O3S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | [(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-(2-ethylbutyl)benzoate |
| SMILES | C=Nc1ccc(-c2csc([C@H](C)C(Cn3cncn3)(OCOC(=O)c3cccc(CC(CC)CC)c3)c3ccc(F)cc3F)n2)cc1 |
| InChI | InChI=1S/C36H37F2N5O3S/c1-5-25(6-2)16-26-8-7-9-28(17-26)35(44)45-23-46-36(20-43-22-40-21-41-43,31-15-12-29(37)18-32(31)38)24(3)34-42-33(19-47-34)27-10-13-30(39-4)14-11-27/h7-15,17-19,21-22,24-25H,4-6,16,20,23H2,1-3H3/t24-,36?/m0/s1 |
| InChIKey | XKUYZIRFKNFTEQ-YIDLWOTISA-N |
| XLogP | 8.52 |
| TPSA | 91.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|