C31H25Cl2F2N5O3S — CID 142626602
[2,6-dichloro-4-[[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-3H-1,2,4-triazol-4-yl]methyl]phenyl] acetate (PubChem CID 142626602) has the molecular formula C31H25Cl2F2N5O3S and a molecular weight of 656.54 g/mol. Its IUPAC name is [2,6-dichloro-4-[[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-3H-1,2,4-triazol-4-yl]methyl]phenyl] acetate.
| Compound Name | [2,6-dichloro-4-[[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-3H-1,2,4-triazol-4-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 142626602 |
| Molecular Formula | C31H25Cl2F2N5O3S |
| Molecular Weight | 656.54 g/mol |
| Exact Mass | 655.10 |
| IUPAC Name | [2,6-dichloro-4-[[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-3H-1,2,4-triazol-4-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(Cl)cc(CN2C=NN(C[C@](O)(c3ccc(F)cc3F)[C@@H](C)c3nc(-c4ccc(C#N)cc4)cs3)C2)cc1Cl |
| InChI | InChI=1S/C31H25Cl2F2N5O3S/c1-18(30-38-28(14-44-30)22-5-3-20(12-36)4-6-22)31(42,24-8-7-23(34)11-27(24)35)15-40-17-39(16-37-40)13-21-9-25(32)29(26(33)10-21)43-19(2)41/h3-11,14,16,18,42H,13,15,17H2,1-2H3/t18-,31+/m0/s1 |
| InChIKey | JREVYSZLILAREY-FZEVHQGJSA-N |
| XLogP | 6.90 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|