C23H17F2N5O3S — CID 24829204
2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazole-3-carboxylic acid (PubChem CID 24829204) has the molecular formula C23H17F2N5O3S and a molecular weight of 481.48 g/mol. Its IUPAC name is 2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 24829204 |
| Molecular Formula | C23H17F2N5O3S |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazole-3-carboxylic acid |
| SMILES | C[C@@H](c1nc(-c2ccc(C#N)cc2)cs1)[C@](O)(Cn1ncnc1C(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H17F2N5O3S/c1-13(21-29-19(10-34-21)15-4-2-14(9-26)3-5-15)23(33,17-7-6-16(24)8-18(17)25)11-30-20(22(31)32)27-12-28-30/h2-8,10,12-13,33H,11H2,1H3,(H,31,32)/t13-,23+/m0/s1 |
| InChIKey | XVMUBZQNUCMMBX-ZAMGYDSWSA-N |
| XLogP | 3.94 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |