C24H20F2N6OS2 — CID 10207724
(2R,3R)-2-(2,4-difluorophenyl)-3-[4-[4-(5-methyl-1,2,4-thiadiazol-3-yl)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 10207724) has the molecular formula C24H20F2N6OS2 and a molecular weight of 510.60 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[4-[4-(5-methyl-1,2,4-thiadiazol-3-yl)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[4-[4-(5-methyl-1,2,4-thiadiazol-3-yl)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 10207724 |
| Molecular Formula | C24H20F2N6OS2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[4-[4-(5-methyl-1,2,4-thiadiazol-3-yl)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | Cc1nc(-c2ccc(-c3csc([C@H](C)[C@](O)(Cn4cncn4)c4ccc(F)cc4F)n3)cc2)ns1 |
| InChI | InChI=1S/C24H20F2N6OS2/c1-14(24(33,11-32-13-27-12-28-32)19-8-7-18(25)9-20(19)26)23-30-21(10-34-23)16-3-5-17(6-4-16)22-29-15(2)35-31-22/h3-10,12-14,33H,11H2,1-2H3/t14-,24+/m0/s1 |
| InChIKey | JJLZLZDSJYUWTD-LFPIHBKWSA-N |
| XLogP | 5.20 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |