C26H18F7N5OS2 — CID 10304405
(2R,3R)-2-(2,4-difluorophenyl)-3-[4-[4-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 10304405) has the molecular formula C26H18F7N5OS2 and a molecular weight of 613.58 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[4-[4-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[4-[4-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 10304405 |
| Molecular Formula | C26H18F7N5OS2 |
| Molecular Weight | 613.58 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[4-[4-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](c1nc(-c2ccc(-c3nc(C(F)(F)C(F)(F)F)cs3)cc2)cs1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C26H18F7N5OS2/c1-14(24(39,11-38-13-34-12-35-38)18-7-6-17(27)8-19(18)28)22-36-20(9-40-22)15-2-4-16(5-3-15)23-37-21(10-41-23)25(29,30)26(31,32)33/h2-10,12-14,39H,11H2,1H3/t14-,24+/m0/s1 |
| InChIKey | GWAGDVIHSOYVTN-LFPIHBKWSA-N |
| XLogP | 7.15 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.58 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|