C21H28FNO3S — CID 57313294
O-[3-(3-fluorophenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate (PubChem CID 57313294) has the molecular formula C21H28FNO3S and a molecular weight of 393.52 g/mol. Its IUPAC name is O-[3-(3-fluorophenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate.
| Compound Name | O-[3-(3-fluorophenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 57313294 |
| Molecular Formula | C21H28FNO3S |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | O-[3-(3-fluorophenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC[C@H]1C(=S)OCCCc1cccc(F)c1 |
| InChI | InChI=1S/C21H28FNO3S/c1-4-21(2,3)18(24)19(25)23-12-6-11-17(23)20(27)26-13-7-9-15-8-5-10-16(22)14-15/h5,8,10,14,17H,4,6-7,9,11-13H2,1-3H3/t17-/m0/s1 |
| InChIKey | QZOQHNFBOWZMDZ-KRWDZBQOSA-N |
| XLogP | 4.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|