C13H18O5 — CID 57315009
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-propylpent-2-enoate (PubChem CID 57315009) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-propylpent-2-enoate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-propylpent-2-enoate |
|---|---|
| PubChem CID | 57315009 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-propylpent-2-enoate |
| SMILES | CCC=C(CCC)C(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C13H18O5/c1-4-6-10(7-5-2)12(14)16-8-11-9(3)17-13(15)18-11/h6H,4-5,7-8H2,1-3H3 |
| InChIKey | QGUZAAZDNDERND-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|