C14H18O3S — CID 57315982
3-(4-methoxyphenyl)sulfanyl-4,4-dimethylpent-2-enoic acid (PubChem CID 57315982) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfanyl-4,4-dimethylpent-2-enoic acid.
| Compound Name | 3-(4-methoxyphenyl)sulfanyl-4,4-dimethylpent-2-enoic acid |
|---|---|
| PubChem CID | 57315982 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfanyl-4,4-dimethylpent-2-enoic acid |
| SMILES | COc1ccc(SC(=CC(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H18O3S/c1-14(2,3)12(9-13(15)16)18-11-7-5-10(17-4)6-8-11/h5-9H,1-4H3,(H,15,16) |
| InChIKey | XPIDNQSTZWQFCV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|