C18H22O4PS+ — CID 57316343
(5-carboxy-5-hydroxy-3-methylpentyl)-(naphthalen-2-ylsulfanylmethyl)-oxophosphanium (PubChem CID 57316343) has the molecular formula C18H22O4PS+ and a molecular weight of 365.41 g/mol. Its IUPAC name is (5-carboxy-5-hydroxy-3-methylpentyl)-(naphthalen-2-ylsulfanylmethyl)-oxophosphanium.
| Compound Name | (5-carboxy-5-hydroxy-3-methylpentyl)-(naphthalen-2-ylsulfanylmethyl)-oxophosphanium |
|---|---|
| PubChem CID | 57316343 |
| Molecular Formula | C18H22O4PS+ |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (5-carboxy-5-hydroxy-3-methylpentyl)-(naphthalen-2-ylsulfanylmethyl)-oxophosphanium |
| SMILES | CC(CC[P+](=O)CSc1ccc2ccccc2c1)CC(O)C(=O)O |
| InChI | InChI=1S/C18H21O4PS/c1-13(10-17(19)18(20)21)8-9-23(22)12-24-16-7-6-14-4-2-3-5-15(14)11-16/h2-7,11,13,17,19H,8-10,12H2,1H3/p+1 |
| InChIKey | HBBRWAKVPPIONW-UHFFFAOYSA-O |
| XLogP | 4.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|