C12H22N4 — CID 57316758
5-decyl-1,2,4-triazol-3-imine (PubChem CID 57316758) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 5-decyl-1,2,4-triazol-3-imine.
| Compound Name | 5-decyl-1,2,4-triazol-3-imine |
|---|---|
| PubChem CID | 57316758 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 5-decyl-1,2,4-triazol-3-imine |
| SMILES | [H]/N=C1\N=NC(CCCCCCCCCC)=N1 |
| InChI | InChI=1S/C12H22N4/c1-2-3-4-5-6-7-8-9-10-11-14-12(13)16-15-11/h13H,2-10H2,1H3/b13-12- |
| InChIKey | ZFBVRCYVDALPEQ-SEYXRHQNSA-N |
| XLogP | 4.32 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|