C8H15N4+ — CID 57091697
(5-hexyl-1,2,4-triazol-3-ylidene)azanium (PubChem CID 57091697) has the molecular formula C8H15N4+ and a molecular weight of 167.24 g/mol. Its IUPAC name is (5-hexyl-1,2,4-triazol-3-ylidene)azanium.
| Compound Name | (5-hexyl-1,2,4-triazol-3-ylidene)azanium |
|---|---|
| PubChem CID | 57091697 |
| Molecular Formula | C8H15N4+ |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (5-hexyl-1,2,4-triazol-3-ylidene)azanium |
| SMILES | CCCCCCC1=NC(=[NH2+])N=N1 |
| InChI | InChI=1S/C8H14N4/c1-2-3-4-5-6-7-10-8(9)12-11-7/h9H,2-6H2,1H3/p+1 |
| InChIKey | ZGJQGKWKWRJXOA-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 62.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|