C28H36N4O3 — CID 57317187
[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-piperazin-1-yl-7,8-dihydronaphthalen-2-yl] acetate (PubChem CID 57317187) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is [5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-piperazin-1-yl-7,8-dihydronaphthalen-2-yl] acetate.
| Compound Name | [5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-piperazin-1-yl-7,8-dihydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 57317187 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | [5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-piperazin-1-yl-7,8-dihydronaphthalen-2-yl] acetate |
| SMILES | COc1ccccc1N1CCN(CC2=C(N3CCNCC3)CCc3cc(OC(C)=O)ccc32)CC1 |
| InChI | InChI=1S/C28H36N4O3/c1-21(33)35-23-8-9-24-22(19-23)7-10-26(31-13-11-29-12-14-31)25(24)20-30-15-17-32(18-16-30)27-5-3-4-6-28(27)34-2/h3-6,8-9,19,29H,7,10-18,20H2,1-2H3 |
| InChIKey | IAYZVQSYKSDPMA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|