C25H29NO4S — CID 57317535
2-[3-[4-(benzenesulfonamido)butyl]-2-propan-2-ylazulen-1-yl]acetic acid (PubChem CID 57317535) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-[3-[4-(benzenesulfonamido)butyl]-2-propan-2-ylazulen-1-yl]acetic acid.
| Compound Name | 2-[3-[4-(benzenesulfonamido)butyl]-2-propan-2-ylazulen-1-yl]acetic acid |
|---|---|
| PubChem CID | 57317535 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-[3-[4-(benzenesulfonamido)butyl]-2-propan-2-ylazulen-1-yl]acetic acid |
| SMILES | CC(C)c1c(CCCCNS(=O)(=O)c2ccccc2)c2cccccc-2c1CC(=O)O |
| InChI | InChI=1S/C25H29NO4S/c1-18(2)25-22(20-13-7-4-8-14-21(20)23(25)17-24(27)28)15-9-10-16-26-31(29,30)19-11-5-3-6-12-19/h3-8,11-14,18,26H,9-10,15-17H2,1-2H3,(H,27,28) |
| InChIKey | KHOLWAVTOAJFOV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|