C25H29NO4S — CID 15020267
3-[(2R)-5-(benzenesulfonamido)pentan-2-yl]-6-propan-2-ylazulene-1-carboxylic acid (PubChem CID 15020267) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 3-[(2R)-5-(benzenesulfonamido)pentan-2-yl]-6-propan-2-ylazulene-1-carboxylic acid.
| Compound Name | 3-[(2R)-5-(benzenesulfonamido)pentan-2-yl]-6-propan-2-ylazulene-1-carboxylic acid |
|---|---|
| PubChem CID | 15020267 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-[(2R)-5-(benzenesulfonamido)pentan-2-yl]-6-propan-2-ylazulene-1-carboxylic acid |
| SMILES | CC(C)c1ccc2c(C(=O)O)cc([C@H](C)CCCNS(=O)(=O)c3ccccc3)c-2cc1 |
| InChI | InChI=1S/C25H29NO4S/c1-17(2)19-11-13-21-22(14-12-19)24(25(27)28)16-23(21)18(3)8-7-15-26-31(29,30)20-9-5-4-6-10-20/h4-6,9-14,16-18,26H,7-8,15H2,1-3H3,(H,27,28)/t18-/m1/s1 |
| InChIKey | CXKSCMWUVDAZTE-GOSISDBHSA-N |
| XLogP | 5.48 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|