C24H26ClNO5S — CID 139605621
3-[4-[(4-chlorophenyl)sulfonylamino]butyl]-6-(1-hydroxypropan-2-yl)azulene-1-carboxylic acid (PubChem CID 139605621) has the molecular formula C24H26ClNO5S and a molecular weight of 475.99 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)sulfonylamino]butyl]-6-(1-hydroxypropan-2-yl)azulene-1-carboxylic acid.
| Compound Name | 3-[4-[(4-chlorophenyl)sulfonylamino]butyl]-6-(1-hydroxypropan-2-yl)azulene-1-carboxylic acid |
|---|---|
| PubChem CID | 139605621 |
| Molecular Formula | C24H26ClNO5S |
| Molecular Weight | 475.99 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)sulfonylamino]butyl]-6-(1-hydroxypropan-2-yl)azulene-1-carboxylic acid |
| SMILES | CC(CO)c1ccc2c(CCCCNS(=O)(=O)c3ccc(Cl)cc3)cc(C(=O)O)c-2cc1 |
| InChI | InChI=1S/C24H26ClNO5S/c1-16(15-27)17-5-11-21-18(14-23(24(28)29)22(21)12-6-17)4-2-3-13-26-32(30,31)20-9-7-19(25)8-10-20/h5-12,14,16,26-27H,2-4,13,15H2,1H3,(H,28,29) |
| InChIKey | UUVZJTZYIWVDRY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.99 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|