C24H28NNaO6S2 — CID 139605612
sodium 6-(1-hydroxypropan-2-yl)-3-[4-[(4-methylphenyl)sulfonylamino]butyl]azulene-1-sulfonate (PubChem CID 139605612) has the molecular formula C24H28NNaO6S2 and a molecular weight of 513.61 g/mol. Its IUPAC name is sodium 6-(1-hydroxypropan-2-yl)-3-[4-[(4-methylphenyl)sulfonylamino]butyl]azulene-1-sulfonate.
| Compound Name | sodium 6-(1-hydroxypropan-2-yl)-3-[4-[(4-methylphenyl)sulfonylamino]butyl]azulene-1-sulfonate |
|---|---|
| PubChem CID | 139605612 |
| Molecular Formula | C24H28NNaO6S2 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | sodium 6-(1-hydroxypropan-2-yl)-3-[4-[(4-methylphenyl)sulfonylamino]butyl]azulene-1-sulfonate |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCc2cc(S(=O)(=O)[O-])c3ccc(C(C)CO)ccc2-3)cc1.[Na+] |
| InChI | InChI=1S/C24H29NO6S2.Na/c1-17-6-10-21(11-7-17)32(27,28)25-14-4-3-5-20-15-24(33(29,30)31)23-13-9-19(18(2)16-26)8-12-22(20)23;/h6-13,15,18,25-26H,3-5,14,16H2,1-2H3,(H,29,30,31);/q;+1/p-1 |
| InChIKey | CYRJMZRJOOTEKL-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|