C24H28ClNO5S2 — CID 57084730
3-[4-[(4-chlorophenyl)sulfonylamino]pentyl]-6-propan-2-ylazulene-1-sulfonic acid (PubChem CID 57084730) has the molecular formula C24H28ClNO5S2 and a molecular weight of 510.08 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)sulfonylamino]pentyl]-6-propan-2-ylazulene-1-sulfonic acid.
| Compound Name | 3-[4-[(4-chlorophenyl)sulfonylamino]pentyl]-6-propan-2-ylazulene-1-sulfonic acid |
|---|---|
| PubChem CID | 57084730 |
| Molecular Formula | C24H28ClNO5S2 |
| Molecular Weight | 510.08 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)sulfonylamino]pentyl]-6-propan-2-ylazulene-1-sulfonic acid |
| SMILES | CC(CCCc1cc(S(=O)(=O)O)c2ccc(C(C)C)ccc1-2)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28ClNO5S2/c1-16(2)18-7-13-22-19(15-24(33(29,30)31)23(22)14-8-18)6-4-5-17(3)26-32(27,28)21-11-9-20(25)10-12-21/h7-17,26H,4-6H2,1-3H3,(H,29,30,31) |
| InChIKey | QKAYEBASEDISKD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.08 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|