C23H26ClNO5S2 — CID 174419730
[3-[4-[(4-chlorophenyl)sulfonylamino]butyl]-6-propan-2-ylazulen-1-yl] hydrogen sulfite (PubChem CID 174419730) has the molecular formula C23H26ClNO5S2 and a molecular weight of 496.05 g/mol. Its IUPAC name is [3-[4-[(4-chlorophenyl)sulfonylamino]butyl]-6-propan-2-ylazulen-1-yl] hydrogen sulfite.
| Compound Name | [3-[4-[(4-chlorophenyl)sulfonylamino]butyl]-6-propan-2-ylazulen-1-yl] hydrogen sulfite |
|---|---|
| PubChem CID | 174419730 |
| Molecular Formula | C23H26ClNO5S2 |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | [3-[4-[(4-chlorophenyl)sulfonylamino]butyl]-6-propan-2-ylazulen-1-yl] hydrogen sulfite |
| SMILES | CC(C)c1ccc2c(CCCCNS(=O)(=O)c3ccc(Cl)cc3)cc(OS(=O)O)c-2cc1 |
| InChI | InChI=1S/C23H26ClNO5S2/c1-16(2)17-6-12-21-18(15-23(30-31(26)27)22(21)13-7-17)5-3-4-14-25-32(28,29)20-10-8-19(24)9-11-20/h6-13,15-16,25H,3-5,14H2,1-2H3,(H,26,27) |
| InChIKey | BVUNRUAUSVCCFX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|