C26H30ClNO4S — CID 67895171
methyl 3-[5-[(4-chlorophenyl)sulfonylamino]pentan-2-yl]-6-propan-2-ylazulene-1-carboxylate (PubChem CID 67895171) has the molecular formula C26H30ClNO4S and a molecular weight of 488.05 g/mol. Its IUPAC name is methyl 3-[5-[(4-chlorophenyl)sulfonylamino]pentan-2-yl]-6-propan-2-ylazulene-1-carboxylate.
| Compound Name | methyl 3-[5-[(4-chlorophenyl)sulfonylamino]pentan-2-yl]-6-propan-2-ylazulene-1-carboxylate |
|---|---|
| PubChem CID | 67895171 |
| Molecular Formula | C26H30ClNO4S |
| Molecular Weight | 488.05 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | methyl 3-[5-[(4-chlorophenyl)sulfonylamino]pentan-2-yl]-6-propan-2-ylazulene-1-carboxylate |
| SMILES | COC(=O)c1cc(C(C)CCCNS(=O)(=O)c2ccc(Cl)cc2)c2ccc(C(C)C)ccc1-2 |
| InChI | InChI=1S/C26H30ClNO4S/c1-17(2)19-7-13-22-23(14-8-19)25(26(29)32-4)16-24(22)18(3)6-5-15-28-33(30,31)21-11-9-20(27)10-12-21/h7-14,16-18,28H,5-6,15H2,1-4H3 |
| InChIKey | GITOTWPRCSNNHN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.05 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|