C17H22N2O2S2 — CID 67598790
N-[4-(4-aminophenyl)sulfanylpentyl]benzenesulfonamide (PubChem CID 67598790) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is N-[4-(4-aminophenyl)sulfanylpentyl]benzenesulfonamide.
| Compound Name | N-[4-(4-aminophenyl)sulfanylpentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67598790 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[4-(4-aminophenyl)sulfanylpentyl]benzenesulfonamide |
| SMILES | CC(CCCNS(=O)(=O)c1ccccc1)Sc1ccc(N)cc1 |
| InChI | InChI=1S/C17H22N2O2S2/c1-14(22-16-11-9-15(18)10-12-16)6-5-13-19-23(20,21)17-7-3-2-4-8-17/h2-4,7-12,14,19H,5-6,13,18H2,1H3 |
| InChIKey | UBZQUXIPKGRFLW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|