C17H19NO4S2 — CID 67586105
4-[(4-methylphenyl)sulfonylamino]-2-phenylsulfanylbutanoic acid (PubChem CID 67586105) has the molecular formula C17H19NO4S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 4-[(4-methylphenyl)sulfonylamino]-2-phenylsulfanylbutanoic acid.
| Compound Name | 4-[(4-methylphenyl)sulfonylamino]-2-phenylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 67586105 |
| Molecular Formula | C17H19NO4S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 4-[(4-methylphenyl)sulfonylamino]-2-phenylsulfanylbutanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(Sc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H19NO4S2/c1-13-7-9-15(10-8-13)24(21,22)18-12-11-16(17(19)20)23-14-5-3-2-4-6-14/h2-10,16,18H,11-12H2,1H3,(H,19,20) |
| InChIKey | COANUTOJLSQLHH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |