C23H23F2N5O — CID 57317683
(2S,3R)-2-(2,4-difluorophenyl)-3-[5-(2,5-dimethyl-1H-pyrrol-3-yl)-2-pyridinyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 57317683) has the molecular formula C23H23F2N5O and a molecular weight of 423.47 g/mol. Its IUPAC name is (2S,3R)-2-(2,4-difluorophenyl)-3-[5-(2,5-dimethyl-1H-pyrrol-3-yl)-2-pyridinyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2S,3R)-2-(2,4-difluorophenyl)-3-[5-(2,5-dimethyl-1H-pyrrol-3-yl)-2-pyridinyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 57317683 |
| Molecular Formula | C23H23F2N5O |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (2S,3R)-2-(2,4-difluorophenyl)-3-[5-(2,5-dimethyl-1H-pyrrol-3-yl)-2-pyridinyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | Cc1cc(-c2ccc([C@@H](C)[C@@](O)(Cn3cncn3)c3ccc(F)cc3F)nc2)c(C)[nH]1 |
| InChI | InChI=1S/C23H23F2N5O/c1-14-8-19(16(3)29-14)17-4-7-22(27-10-17)15(2)23(31,11-30-13-26-12-28-30)20-6-5-18(24)9-21(20)25/h4-10,12-13,15,29,31H,11H2,1-3H3/t15-,23+/m1/s1 |
| InChIKey | XEAZDZYCUPFVRE-CMJOXMDJSA-N |
| XLogP | 4.25 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |