C22H31NO3 — CID 57319911
(8R,9R,10R,13S,14S)-7-ethenyl-17-hydroxy-10,13,17-trimethyl-2-nitroso-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57319911) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-7-ethenyl-17-hydroxy-10,13,17-trimethyl-2-nitroso-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13S,14S)-7-ethenyl-17-hydroxy-10,13,17-trimethyl-2-nitroso-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57319911 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (8R,9R,10R,13S,14S)-7-ethenyl-17-hydroxy-10,13,17-trimethyl-2-nitroso-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=CC1CC2=CC(=O)C(N=O)C[C@]2(C)[C@@H]2CC[C@@]3(C)[C@@H](CCC3(C)O)[C@H]12 |
| InChI | InChI=1S/C22H31NO3/c1-5-13-10-14-11-18(24)17(23-26)12-20(14,2)15-6-8-21(3)16(19(13)15)7-9-22(21,4)25/h5,11,13,15-17,19,25H,1,6-10,12H2,2-4H3/t13?,15-,16+,17?,19-,20+,21+,22?/m1/s1 |
| InChIKey | MEDAWKXIHMVHHT-MJWSNVHASA-N |
| XLogP | 4.43 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|