About N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine
N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine (PubChem CID 57320157) has the molecular formula C15H36N4O2
and a molecular weight of 304.48 g/mol. Its IUPAC name is N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine |
| PubChem CID | 57320157 |
| Molecular Formula | C15H36N4O2 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine |
| SMILES | CC(CN(CCCN)CC(C)OCCCN)OCCCN |
| InChI | InChI=1S/C15H36N4O2/c1-14(20-10-4-7-17)12-19(9-3-6-16)13-15(2)21-11-5-8-18/h14-15H,3-13,16-18H2,1-2H3 |
| InChIKey | SWRYMNSZBHPDQD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine?
The IUPAC name of N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine (CID 57320157) is N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine.
What is the SMILES notation for N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine?
The canonical SMILES for N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine is CC(CN(CCCN)CC(C)OCCCN)OCCCN.
What is the InChIKey of N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine?
The InChIKey is SWRYMNSZBHPDQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H36N4O2/c1-14(20-10-4-7-17)12-19(9-3-6-16)13-15(2)21-11-5-8-18/h14-15H,3-13,16-18H2,1-2H3.
What are the key properties of N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine?
N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine has a molecular weight of 304.48 g/mol, XLogP of 0.14, 15 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-bis[2-(3-aminopropoxy)propyl]propane-1,3-diamine is sourced from PubChem (CID 57320157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).