C6H7IN2O3 — CID 57320492
2-(2,5-dihydroxypyrrol-1-yl)-2-iodoacetamide (PubChem CID 57320492) has the molecular formula C6H7IN2O3 and a molecular weight of 282.04 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-2-iodoacetamide.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-2-iodoacetamide |
|---|---|
| PubChem CID | 57320492 |
| Molecular Formula | C6H7IN2O3 |
| Molecular Weight | 282.04 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-2-iodoacetamide |
| SMILES | NC(=O)C(I)n1c(O)ccc1O |
| InChI | InChI=1S/C6H7IN2O3/c7-5(6(8)12)9-3(10)1-2-4(9)11/h1-2,5,10-11H,(H2,8,12) |
| InChIKey | AEONJYPGXQAQCW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.04 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|