C25H32N2O5S — CID 57321045
(3S)-3-(1,3-benzodioxol-5-yl)-3-[[(2S)-3-methyl-1-(3-phenylpropylsulfanyl)butan-2-yl]carbamoylamino]propanoic acid (PubChem CID 57321045) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is (3S)-3-(1,3-benzodioxol-5-yl)-3-[[(2S)-3-methyl-1-(3-phenylpropylsulfanyl)butan-2-yl]carbamoylamino]propanoic acid.
| Compound Name | (3S)-3-(1,3-benzodioxol-5-yl)-3-[[(2S)-3-methyl-1-(3-phenylpropylsulfanyl)butan-2-yl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 57321045 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (3S)-3-(1,3-benzodioxol-5-yl)-3-[[(2S)-3-methyl-1-(3-phenylpropylsulfanyl)butan-2-yl]carbamoylamino]propanoic acid |
| SMILES | CC(C)[C@@H](CSCCCc1ccccc1)NC(=O)N[C@@H](CC(=O)O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H32N2O5S/c1-17(2)21(15-33-12-6-9-18-7-4-3-5-8-18)27-25(30)26-20(14-24(28)29)19-10-11-22-23(13-19)32-16-31-22/h3-5,7-8,10-11,13,17,20-21H,6,9,12,14-16H2,1-2H3,(H,28,29)(H2,26,27,30)/t20-,21+/m0/s1 |
| InChIKey | URRFVPJFGUUAQQ-LEWJYISDSA-N |
| XLogP | 4.62 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|