C24H29N3O7S — CID 57282146
(3S)-3-(1,3-benzodioxol-5-yl)-3-[[(2S)-5-(methoxycarbonylamino)-1-phenylsulfanylpentan-2-yl]carbamoylamino]propanoic acid (PubChem CID 57282146) has the molecular formula C24H29N3O7S and a molecular weight of 503.58 g/mol. Its IUPAC name is (3S)-3-(1,3-benzodioxol-5-yl)-3-[[(2S)-5-(methoxycarbonylamino)-1-phenylsulfanylpentan-2-yl]carbamoylamino]propanoic acid.
| Compound Name | (3S)-3-(1,3-benzodioxol-5-yl)-3-[[(2S)-5-(methoxycarbonylamino)-1-phenylsulfanylpentan-2-yl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 57282146 |
| Molecular Formula | C24H29N3O7S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (3S)-3-(1,3-benzodioxol-5-yl)-3-[[(2S)-5-(methoxycarbonylamino)-1-phenylsulfanylpentan-2-yl]carbamoylamino]propanoic acid |
| SMILES | COC(=O)NCCC[C@@H](CSc1ccccc1)NC(=O)N[C@@H](CC(=O)O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H29N3O7S/c1-32-24(31)25-11-5-6-17(14-35-18-7-3-2-4-8-18)26-23(30)27-19(13-22(28)29)16-9-10-20-21(12-16)34-15-33-20/h2-4,7-10,12,17,19H,5-6,11,13-15H2,1H3,(H,25,31)(H,28,29)(H2,26,27,30)/t17-,19-/m0/s1 |
| InChIKey | SLRIOWOGOZXBHA-HKUYNNGSSA-N |
| XLogP | 3.53 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|