C26H33N5O8 — CID 68526398
(3S)-3-[[(2S)-1-[(4-aminophenyl)methylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamoylamino]-3-(1,3-benzodioxol-5-yl)propanoic acid (PubChem CID 68526398) has the molecular formula C26H33N5O8 and a molecular weight of 543.58 g/mol. Its IUPAC name is (3S)-3-[[(2S)-1-[(4-aminophenyl)methylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamoylamino]-3-(1,3-benzodioxol-5-yl)propanoic acid.
| Compound Name | (3S)-3-[[(2S)-1-[(4-aminophenyl)methylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamoylamino]-3-(1,3-benzodioxol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 68526398 |
| Molecular Formula | C26H33N5O8 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | (3S)-3-[[(2S)-1-[(4-aminophenyl)methylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamoylamino]-3-(1,3-benzodioxol-5-yl)propanoic acid |
| SMILES | COC(=O)NCCCC[C@H](NC(=O)N[C@@H](CC(=O)O)c1ccc2c(c1)OCO2)C(=O)NCc1ccc(N)cc1 |
| InChI | InChI=1S/C26H33N5O8/c1-37-26(36)28-11-3-2-4-19(24(34)29-14-16-5-8-18(27)9-6-16)30-25(35)31-20(13-23(32)33)17-7-10-21-22(12-17)39-15-38-21/h5-10,12,19-20H,2-4,11,13-15,27H2,1H3,(H,28,36)(H,29,34)(H,32,33)(H2,30,31,35)/t19-,20-/m0/s1 |
| InChIKey | JBVGDYUGDJTXKU-PMACEKPBSA-N |
| XLogP | 2.02 |
| TPSA | 190.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|