C27H35N5O7 — CID 68524829
(3S)-5-[[(2S)-1-[(4-aminophenyl)methylamino]-6-(methylcarbamoylamino)-1-oxohexan-2-yl]amino]-3-(1,3-benzodioxol-5-yl)-5-oxopentanoic acid (PubChem CID 68524829) has the molecular formula C27H35N5O7 and a molecular weight of 541.61 g/mol. Its IUPAC name is (3S)-5-[[(2S)-1-[(4-aminophenyl)methylamino]-6-(methylcarbamoylamino)-1-oxohexan-2-yl]amino]-3-(1,3-benzodioxol-5-yl)-5-oxopentanoic acid.
| Compound Name | (3S)-5-[[(2S)-1-[(4-aminophenyl)methylamino]-6-(methylcarbamoylamino)-1-oxohexan-2-yl]amino]-3-(1,3-benzodioxol-5-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 68524829 |
| Molecular Formula | C27H35N5O7 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | (3S)-5-[[(2S)-1-[(4-aminophenyl)methylamino]-6-(methylcarbamoylamino)-1-oxohexan-2-yl]amino]-3-(1,3-benzodioxol-5-yl)-5-oxopentanoic acid |
| SMILES | CNC(=O)NCCCC[C@H](NC(=O)C[C@@H](CC(=O)O)c1ccc2c(c1)OCO2)C(=O)NCc1ccc(N)cc1 |
| InChI | InChI=1S/C27H35N5O7/c1-29-27(37)30-11-3-2-4-21(26(36)31-15-17-5-8-20(28)9-6-17)32-24(33)13-19(14-25(34)35)18-7-10-22-23(12-18)39-16-38-22/h5-10,12,19,21H,2-4,11,13-16,28H2,1H3,(H,31,36)(H,32,33)(H,34,35)(H2,29,30,37)/t19-,21-/m0/s1 |
| InChIKey | NUNJNIWTJKZSPF-FPOVZHCZSA-N |
| XLogP | 1.85 |
| TPSA | 181.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|