C21H30N2O2 — CID 57321062
methyl N-[1-[1-(cyclobuten-1-yl)-2-phenylethyl]piperidin-4-yl]-N-ethylcarbamate (PubChem CID 57321062) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is methyl N-[1-[1-(cyclobuten-1-yl)-2-phenylethyl]piperidin-4-yl]-N-ethylcarbamate.
| Compound Name | methyl N-[1-[1-(cyclobuten-1-yl)-2-phenylethyl]piperidin-4-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 57321062 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | methyl N-[1-[1-(cyclobuten-1-yl)-2-phenylethyl]piperidin-4-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC)C1CCN(C(Cc2ccccc2)C2=CCC2)CC1 |
| InChI | InChI=1S/C21H30N2O2/c1-3-23(21(24)25-2)19-12-14-22(15-13-19)20(18-10-7-11-18)16-17-8-5-4-6-9-17/h4-6,8-10,19-20H,3,7,11-16H2,1-2H3 |
| InChIKey | HZLAAPRIJQJIHE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|