C25H36N2O2 — CID 56980237
cyclohexyl N-[1-[1-(cyclobuten-1-yl)-2-phenylethyl]piperidin-4-yl]-N-methylcarbamate (PubChem CID 56980237) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is cyclohexyl N-[1-[1-(cyclobuten-1-yl)-2-phenylethyl]piperidin-4-yl]-N-methylcarbamate.
| Compound Name | cyclohexyl N-[1-[1-(cyclobuten-1-yl)-2-phenylethyl]piperidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 56980237 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | cyclohexyl N-[1-[1-(cyclobuten-1-yl)-2-phenylethyl]piperidin-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC1CCCCC1)C1CCN(C(Cc2ccccc2)C2=CCC2)CC1 |
| InChI | InChI=1S/C25H36N2O2/c1-26(25(28)29-23-13-6-3-7-14-23)22-15-17-27(18-16-22)24(21-11-8-12-21)19-20-9-4-2-5-10-20/h2,4-5,9-11,22-24H,3,6-8,12-19H2,1H3 |
| InChIKey | UGCVYKVSODKYFS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|