C31H34N2O4 — CID 57322643
4-[[1-benzyl-5-(hexanoylamino)indol-3-yl]methyl]-5-methoxy-2-methylbenzoic acid (PubChem CID 57322643) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is 4-[[1-benzyl-5-(hexanoylamino)indol-3-yl]methyl]-5-methoxy-2-methylbenzoic acid.
| Compound Name | 4-[[1-benzyl-5-(hexanoylamino)indol-3-yl]methyl]-5-methoxy-2-methylbenzoic acid |
|---|---|
| PubChem CID | 57322643 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 4-[[1-benzyl-5-(hexanoylamino)indol-3-yl]methyl]-5-methoxy-2-methylbenzoic acid |
| SMILES | CCCCCC(=O)Nc1ccc2c(c1)c(Cc1cc(C)c(C(=O)O)cc1OC)cn2Cc1ccccc1 |
| InChI | InChI=1S/C31H34N2O4/c1-4-5-7-12-30(34)32-25-13-14-28-27(17-25)24(20-33(28)19-22-10-8-6-9-11-22)16-23-15-21(2)26(31(35)36)18-29(23)37-3/h6,8-11,13-15,17-18,20H,4-5,7,12,16,19H2,1-3H3,(H,32,34)(H,35,36) |
| InChIKey | DOAQKTKTWVGLOP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|