C8H12N2 — CID 57323444
1-methyl-1,4,6,8a-tetrahydropyrrolo[1,2-a]pyrazine (PubChem CID 57323444) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 1-methyl-1,4,6,8a-tetrahydropyrrolo[1,2-a]pyrazine.
| Compound Name | 1-methyl-1,4,6,8a-tetrahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 57323444 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1-methyl-1,4,6,8a-tetrahydropyrrolo[1,2-a]pyrazine |
| SMILES | CC1N=CCN2CC=CC12 |
| InChI | InChI=1S/C8H12N2/c1-7-8-3-2-5-10(8)6-4-9-7/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | LZALMXYTXXOLQN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|