3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate

C37H50O3 — CID 57324037

IUPAC3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate
SMILESCCCCC(CC(CC)c1ccccc1)OC(=O)c1ccccc1OC(CCCC)CC(CC)c1ccccc1
InChIInChI=1S/C37H50O3/c1-5-9-23-33(27-29(7-3)31-19-13-11-14-20-31)39-36-26-18-17-25-35(36)37(38)40-34(24-10-6-2)28-30(8-4)32-21-15-12-16-22-32/h11-22,25-26,29-30,33-34H,5-10,23-24,27-28H2,1-4H3
InChIKeyQUVCKJBLXXTWRJ-UHFFFAOYSA-N
MW542.80 g/mol
LogP10.51
Rot. Bonds18

About 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate

3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate (PubChem CID 57324037) has the molecular formula C37H50O3 and a molecular weight of 542.80 g/mol. Its IUPAC name is 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate.

Molecular Properties

Compound Name3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate
PubChem CID57324037
Molecular FormulaC37H50O3
Molecular Weight542.80 g/mol
Exact Mass542.38
IUPAC Name3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate
SMILESCCCCC(CC(CC)c1ccccc1)OC(=O)c1ccccc1OC(CCCC)CC(CC)c1ccccc1
InChIInChI=1S/C37H50O3/c1-5-9-23-33(27-29(7-3)31-19-13-11-14-20-31)39-36-26-18-17-25-35(36)37(38)40-34(24-10-6-2)28-30(8-4)32-21-15-12-16-22-32/h11-22,25-26,29-30,33-34H,5-10,23-24,27-28H2,1-4H3
InChIKeyQUVCKJBLXXTWRJ-UHFFFAOYSA-N
XLogP10.51
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds18
Heavy Atoms40
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500542.80
LogP ≤ 510.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate?
The IUPAC name of 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate (CID 57324037) is 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate.
What is the SMILES notation for 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate?
The canonical SMILES for 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate is CCCCC(CC(CC)c1ccccc1)OC(=O)c1ccccc1OC(CCCC)CC(CC)c1ccccc1.
What is the InChIKey of 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate?
The InChIKey is QUVCKJBLXXTWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H50O3/c1-5-9-23-33(27-29(7-3)31-19-13-11-14-20-31)39-36-26-18-17-25-35(36)37(38)40-34(24-10-6-2)28-30(8-4)32-21-15-12-16-22-32/h11-22,25-26,29-30,33-34H,5-10,23-24,27-28H2,1-4H3.
What are the key properties of 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate?
3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate has a molecular weight of 542.80 g/mol, XLogP of 10.51, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate is sourced from PubChem (CID 57324037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).