About 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate
3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate (PubChem CID 57324037) has the molecular formula C37H50O3
and a molecular weight of 542.80 g/mol. Its IUPAC name is 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate.
Molecular Properties
| Compound Name | 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate |
| PubChem CID | 57324037 |
| Molecular Formula | C37H50O3 |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate |
| SMILES | CCCCC(CC(CC)c1ccccc1)OC(=O)c1ccccc1OC(CCCC)CC(CC)c1ccccc1 |
| InChI | InChI=1S/C37H50O3/c1-5-9-23-33(27-29(7-3)31-19-13-11-14-20-31)39-36-26-18-17-25-35(36)37(38)40-34(24-10-6-2)28-30(8-4)32-21-15-12-16-22-32/h11-22,25-26,29-30,33-34H,5-10,23-24,27-28H2,1-4H3 |
| InChIKey | QUVCKJBLXXTWRJ-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate?
The IUPAC name of 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate (CID 57324037) is 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate.
What is the SMILES notation for 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate?
The canonical SMILES for 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate is CCCCC(CC(CC)c1ccccc1)OC(=O)c1ccccc1OC(CCCC)CC(CC)c1ccccc1.
What is the InChIKey of 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate?
The InChIKey is QUVCKJBLXXTWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H50O3/c1-5-9-23-33(27-29(7-3)31-19-13-11-14-20-31)39-36-26-18-17-25-35(36)37(38)40-34(24-10-6-2)28-30(8-4)32-21-15-12-16-22-32/h11-22,25-26,29-30,33-34H,5-10,23-24,27-28H2,1-4H3.
What are the key properties of 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate?
3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate has a molecular weight of 542.80 g/mol, XLogP of 10.51, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylnonan-5-yl 2-(3-phenylnonan-5-yloxy)benzoate is sourced from PubChem (CID 57324037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).