C13H13NO3S2 — CID 57324719
5-(3-oxo-3-phenylpropanethioyl)-1,3-thiazolidine-3-carboxylic acid (PubChem CID 57324719) has the molecular formula C13H13NO3S2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 5-(3-oxo-3-phenylpropanethioyl)-1,3-thiazolidine-3-carboxylic acid.
| Compound Name | 5-(3-oxo-3-phenylpropanethioyl)-1,3-thiazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 57324719 |
| Molecular Formula | C13H13NO3S2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5-(3-oxo-3-phenylpropanethioyl)-1,3-thiazolidine-3-carboxylic acid |
| SMILES | O=C(CC(=S)C1CN(C(=O)O)CS1)c1ccccc1 |
| InChI | InChI=1S/C13H13NO3S2/c15-10(9-4-2-1-3-5-9)6-11(18)12-7-14(8-19-12)13(16)17/h1-5,12H,6-8H2,(H,16,17) |
| InChIKey | BKGBGOJLWZAUFJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|