C12H12FNO3S — CID 90713074
(2S,4R)-2-(4-fluorobenzoyl)-4-sulfanylpyrrolidine-1-carboxylic acid (PubChem CID 90713074) has the molecular formula C12H12FNO3S and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S,4R)-2-(4-fluorobenzoyl)-4-sulfanylpyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-2-(4-fluorobenzoyl)-4-sulfanylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90713074 |
| Molecular Formula | C12H12FNO3S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (2S,4R)-2-(4-fluorobenzoyl)-4-sulfanylpyrrolidine-1-carboxylic acid |
| SMILES | O=C(c1ccc(F)cc1)[C@@H]1C[C@@H](S)CN1C(=O)O |
| InChI | InChI=1S/C12H12FNO3S/c13-8-3-1-7(2-4-8)11(15)10-5-9(18)6-14(10)12(16)17/h1-4,9-10,18H,5-6H2,(H,16,17)/t9-,10+/m1/s1 |
| InChIKey | ZGKQVQGYOWHYQR-ZJUUUORDSA-N |
| XLogP | 2.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|