C28H31ClF3N5O6 — CID 57326994
(3S)-N-[(2-chlorophenyl)methyl]-1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperidine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 57326994) has the molecular formula C28H31ClF3N5O6 and a molecular weight of 626.03 g/mol. Its IUPAC name is (3S)-N-[(2-chlorophenyl)methyl]-1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperidine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3S)-N-[(2-chlorophenyl)methyl]-1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperidine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 57326994 |
| Molecular Formula | C28H31ClF3N5O6 |
| Molecular Weight | 626.03 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | (3S)-N-[(2-chlorophenyl)methyl]-1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperidine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(Nc2nccc(N3CCC[C@H](C(=O)NCc4ccccc4Cl)C3)n2)cc(OC)c1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H30ClN5O4.C2HF3O2/c1-34-21-13-19(14-22(35-2)24(21)36-3)30-26-28-11-10-23(31-26)32-12-6-8-18(16-32)25(33)29-15-17-7-4-5-9-20(17)27;3-2(4,5)1(6)7/h4-5,7,9-11,13-14,18H,6,8,12,15-16H2,1-3H3,(H,29,33)(H,28,30,31);(H,6,7)/t18-;/m0./s1 |
| InChIKey | SQQFFFLUUFAILA-FERBBOLQSA-N |
| XLogP | 5.07 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.03 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |