C31H32O15 — CID 57327455
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(5-hydroxy-6,7-dimethoxy-4-oxochromen-2-yl)phenoxy]oxan-2-yl]methyl acetate (PubChem CID 57327455) has the molecular formula C31H32O15 and a molecular weight of 644.58 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(5-hydroxy-6,7-dimethoxy-4-oxochromen-2-yl)phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(5-hydroxy-6,7-dimethoxy-4-oxochromen-2-yl)phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 57327455 |
| Molecular Formula | C31H32O15 |
| Molecular Weight | 644.58 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(5-hydroxy-6,7-dimethoxy-4-oxochromen-2-yl)phenoxy]oxan-2-yl]methyl acetate |
| SMILES | COc1cc2oc(-c3ccc(O[C@@H]4O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]4OC(C)=O)cc3)cc(=O)c2c(O)c1OC |
| InChI | InChI=1S/C31H32O15/c1-14(32)40-13-24-28(41-15(2)33)29(42-16(3)34)30(43-17(4)35)31(46-24)44-19-9-7-18(8-10-19)21-11-20(36)25-22(45-21)12-23(38-5)27(39-6)26(25)37/h7-12,24,28-31,37H,13H2,1-6H3/t24-,28-,29+,30-,31-/m1/s1 |
| InChIKey | UDLDEWXNAVRUQR-IEDCVRSGSA-N |
| XLogP | 2.64 |
| TPSA | 192.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|