C25H33N5O5S — CID 57328927
(3aR,6aS)-5-[[4-(4-cyano-2-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]-5-N-hydroxy-2-N,2-N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2,5-dicarboxamide (PubChem CID 57328927) has the molecular formula C25H33N5O5S and a molecular weight of 515.64 g/mol. Its IUPAC name is (3aR,6aS)-5-[[4-(4-cyano-2-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]-5-N-hydroxy-2-N,2-N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2,5-dicarboxamide.
| Compound Name | (3aR,6aS)-5-[[4-(4-cyano-2-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]-5-N-hydroxy-2-N,2-N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 57328927 |
| Molecular Formula | C25H33N5O5S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | (3aR,6aS)-5-[[4-(4-cyano-2-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]-5-N-hydroxy-2-N,2-N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2,5-dicarboxamide |
| SMILES | Cc1cc(C#N)ccc1C1=CCN(S(=O)(=O)CC2(C(=O)NO)C[C@H]3CN(C(=O)N(C)C)C[C@H]3C2)CC1 |
| InChI | InChI=1S/C25H33N5O5S/c1-17-10-18(13-26)4-5-22(17)19-6-8-30(9-7-19)36(34,35)16-25(23(31)27-33)11-20-14-29(15-21(20)12-25)24(32)28(2)3/h4-6,10,20-21,33H,7-9,11-12,14-16H2,1-3H3,(H,27,31)/t20-,21+,25? |
| InChIKey | NNGAWMMVXIDGQY-KEVCNVLYSA-N |
| XLogP | 1.80 |
| TPSA | 134.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|