C25H33N5O5 — CID 11363711
(2S,3S,5S)-2-[4-(4-cyano-2-methylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]-N-hydroxy-5-[2-(2-methoxyethylamino)-2-oxoethyl]piperidine-3-carboxamide (PubChem CID 11363711) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is (2S,3S,5S)-2-[4-(4-cyano-2-methylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]-N-hydroxy-5-[2-(2-methoxyethylamino)-2-oxoethyl]piperidine-3-carboxamide.
| Compound Name | (2S,3S,5S)-2-[4-(4-cyano-2-methylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]-N-hydroxy-5-[2-(2-methoxyethylamino)-2-oxoethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11363711 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | (2S,3S,5S)-2-[4-(4-cyano-2-methylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]-N-hydroxy-5-[2-(2-methoxyethylamino)-2-oxoethyl]piperidine-3-carboxamide |
| SMILES | COCCNC(=O)C[C@H]1CN[C@H](C(=O)N2CC=C(c3ccc(C#N)cc3C)CC2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C25H33N5O5/c1-16-11-17(14-26)3-4-20(16)19-5-8-30(9-6-19)25(33)23-21(24(32)29-34)12-18(15-28-23)13-22(31)27-7-10-35-2/h3-5,11,18,21,23,28,34H,6-10,12-13,15H2,1-2H3,(H,27,31)(H,29,32)/t18-,21-,23-/m0/s1 |
| InChIKey | JGMVROZIXMXSHJ-HARLFGEKSA-N |
| XLogP | 0.73 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|