C23H32N6O5 — CID 11431393
(2S,3S,5R)-2-[4-(4-cyano-2-methylphenyl)piperazine-1-carbonyl]-N-hydroxy-5-[(2-methoxyacetyl)-methylamino]piperidine-3-carboxamide (PubChem CID 11431393) has the molecular formula C23H32N6O5 and a molecular weight of 472.55 g/mol. Its IUPAC name is (2S,3S,5R)-2-[4-(4-cyano-2-methylphenyl)piperazine-1-carbonyl]-N-hydroxy-5-[(2-methoxyacetyl)-methylamino]piperidine-3-carboxamide.
| Compound Name | (2S,3S,5R)-2-[4-(4-cyano-2-methylphenyl)piperazine-1-carbonyl]-N-hydroxy-5-[(2-methoxyacetyl)-methylamino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11431393 |
| Molecular Formula | C23H32N6O5 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | (2S,3S,5R)-2-[4-(4-cyano-2-methylphenyl)piperazine-1-carbonyl]-N-hydroxy-5-[(2-methoxyacetyl)-methylamino]piperidine-3-carboxamide |
| SMILES | COCC(=O)N(C)[C@H]1CN[C@H](C(=O)N2CCN(c3ccc(C#N)cc3C)CC2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C23H32N6O5/c1-15-10-16(12-24)4-5-19(15)28-6-8-29(9-7-28)23(32)21-18(22(31)26-33)11-17(13-25-21)27(2)20(30)14-34-3/h4-5,10,17-18,21,25,33H,6-9,11,13-14H2,1-3H3,(H,26,31)/t17-,18+,21+/m1/s1 |
| InChIKey | SSRKXHCEFUYXFZ-LQWHRVPQSA-N |
| XLogP | -0.53 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|