C21H27N5O3 — CID 87234273
6-[4-(4-cyano-2-methylphenyl)piperazine-1-carbonyl]-N-hydroxy-5-azaspiro[2.5]octane-7-carboxamide (PubChem CID 87234273) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 6-[4-(4-cyano-2-methylphenyl)piperazine-1-carbonyl]-N-hydroxy-5-azaspiro[2.5]octane-7-carboxamide.
| Compound Name | 6-[4-(4-cyano-2-methylphenyl)piperazine-1-carbonyl]-N-hydroxy-5-azaspiro[2.5]octane-7-carboxamide |
|---|---|
| PubChem CID | 87234273 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 6-[4-(4-cyano-2-methylphenyl)piperazine-1-carbonyl]-N-hydroxy-5-azaspiro[2.5]octane-7-carboxamide |
| SMILES | Cc1cc(C#N)ccc1N1CCN(C(=O)C2NCC3(CC3)CC2C(=O)NO)CC1 |
| InChI | InChI=1S/C21H27N5O3/c1-14-10-15(12-22)2-3-17(14)25-6-8-26(9-7-25)20(28)18-16(19(27)24-29)11-21(4-5-21)13-23-18/h2-3,10,16,18,23,29H,4-9,11,13H2,1H3,(H,24,27) |
| InChIKey | GRIWYPFXSXJHPV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|