C21H28N4O5 — CID 59305101
(6S,7S)-N-hydroxy-7-[4-(2-methyl-4-nitrophenyl)piperazine-1-carbonyl]spiro[2.5]octane-6-carboxamide (PubChem CID 59305101) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is (6S,7S)-N-hydroxy-7-[4-(2-methyl-4-nitrophenyl)piperazine-1-carbonyl]spiro[2.5]octane-6-carboxamide.
| Compound Name | (6S,7S)-N-hydroxy-7-[4-(2-methyl-4-nitrophenyl)piperazine-1-carbonyl]spiro[2.5]octane-6-carboxamide |
|---|---|
| PubChem CID | 59305101 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (6S,7S)-N-hydroxy-7-[4-(2-methyl-4-nitrophenyl)piperazine-1-carbonyl]spiro[2.5]octane-6-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1CCN(C(=O)[C@H]2CC3(CC[C@@H]2C(=O)NO)CC3)CC1 |
| InChI | InChI=1S/C21H28N4O5/c1-14-12-15(25(29)30)2-3-18(14)23-8-10-24(11-9-23)20(27)17-13-21(6-7-21)5-4-16(17)19(26)22-28/h2-3,12,16-17,28H,4-11,13H2,1H3,(H,22,26)/t16-,17-/m0/s1 |
| InChIKey | RQZLREWLRJPXPE-IRXDYDNUSA-N |
| XLogP | 2.25 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|