C20H28N4O5 — CID 87870438
[(6S)-5-(hydroxycarbamoyl)-6-(4-phenylpiperidine-1-carbonyl)piperidin-3-yl]methylcarbamic acid (PubChem CID 87870438) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is [(6S)-5-(hydroxycarbamoyl)-6-(4-phenylpiperidine-1-carbonyl)piperidin-3-yl]methylcarbamic acid.
| Compound Name | [(6S)-5-(hydroxycarbamoyl)-6-(4-phenylpiperidine-1-carbonyl)piperidin-3-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 87870438 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | [(6S)-5-(hydroxycarbamoyl)-6-(4-phenylpiperidine-1-carbonyl)piperidin-3-yl]methylcarbamic acid |
| SMILES | O=C(O)NCC1CN[C@H](C(=O)N2CCC(c3ccccc3)CC2)C(C(=O)NO)C1 |
| InChI | InChI=1S/C20H28N4O5/c25-18(23-29)16-10-13(12-22-20(27)28)11-21-17(16)19(26)24-8-6-15(7-9-24)14-4-2-1-3-5-14/h1-5,13,15-17,21-22,29H,6-12H2,(H,23,25)(H,27,28)/t13?,16?,17-/m0/s1 |
| InChIKey | AYBKQKXBUDWLPA-IMRCBTMISA-N |
| XLogP | 0.76 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|