C27H40N4O5 — CID 72758726
N-hydroxy-5-(2-morpholin-4-yl-2-oxoethyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-3-carboxamide (PubChem CID 72758726) has the molecular formula C27H40N4O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is N-hydroxy-5-(2-morpholin-4-yl-2-oxoethyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-3-carboxamide.
| Compound Name | N-hydroxy-5-(2-morpholin-4-yl-2-oxoethyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72758726 |
| Molecular Formula | C27H40N4O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | N-hydroxy-5-(2-morpholin-4-yl-2-oxoethyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-3-carboxamide |
| SMILES | CC(C)c1cccc(C2CCN(C(=O)C3NCC(CC(=O)N4CCOCC4)CC3C(=O)NO)CC2)c1 |
| InChI | InChI=1S/C27H40N4O5/c1-18(2)21-4-3-5-22(16-21)20-6-8-31(9-7-20)27(34)25-23(26(33)29-35)14-19(17-28-25)15-24(32)30-10-12-36-13-11-30/h3-5,16,18-20,23,25,28,35H,6-15,17H2,1-2H3,(H,29,33) |
| InChIKey | QJQGITNSLIYJNL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|