C32H43N5O6 — CID 11786675
5-[[2-[(5S,6S)-5-(hydroxycarbamoyl)-6-(3-phenylpyrrolidine-1-carbonyl)piperidin-3-yl]acetyl]amino]pentyl N-benzylcarbamate (PubChem CID 11786675) has the molecular formula C32H43N5O6 and a molecular weight of 593.73 g/mol. Its IUPAC name is 5-[[2-[(5S,6S)-5-(hydroxycarbamoyl)-6-(3-phenylpyrrolidine-1-carbonyl)piperidin-3-yl]acetyl]amino]pentyl N-benzylcarbamate.
| Compound Name | 5-[[2-[(5S,6S)-5-(hydroxycarbamoyl)-6-(3-phenylpyrrolidine-1-carbonyl)piperidin-3-yl]acetyl]amino]pentyl N-benzylcarbamate |
|---|---|
| PubChem CID | 11786675 |
| Molecular Formula | C32H43N5O6 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.32 |
| IUPAC Name | 5-[[2-[(5S,6S)-5-(hydroxycarbamoyl)-6-(3-phenylpyrrolidine-1-carbonyl)piperidin-3-yl]acetyl]amino]pentyl N-benzylcarbamate |
| SMILES | O=C(CC1CN[C@H](C(=O)N2CCC(c3ccccc3)C2)[C@@H](C(=O)NO)C1)NCCCCCOC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H43N5O6/c38-28(33-15-8-3-9-17-43-32(41)35-20-23-10-4-1-5-11-23)19-24-18-27(30(39)36-42)29(34-21-24)31(40)37-16-14-26(22-37)25-12-6-2-7-13-25/h1-2,4-7,10-13,24,26-27,29,34,42H,3,8-9,14-22H2,(H,33,38)(H,35,41)(H,36,39)/t24?,26?,27-,29-/m0/s1 |
| InChIKey | OGTRHHFQXROWSG-QBDLAISOSA-N |
| XLogP | 2.71 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|