C20H26N2O3 — CID 87234865
(6S)-N-hydroxy-6-[(3R)-3-phenylpyrrolidine-1-carbonyl]spiro[2.5]octane-7-carboxamide (PubChem CID 87234865) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is (6S)-N-hydroxy-6-[(3R)-3-phenylpyrrolidine-1-carbonyl]spiro[2.5]octane-7-carboxamide.
| Compound Name | (6S)-N-hydroxy-6-[(3R)-3-phenylpyrrolidine-1-carbonyl]spiro[2.5]octane-7-carboxamide |
|---|---|
| PubChem CID | 87234865 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (6S)-N-hydroxy-6-[(3R)-3-phenylpyrrolidine-1-carbonyl]spiro[2.5]octane-7-carboxamide |
| SMILES | O=C(NO)C1CC2(CC[C@@H]1C(=O)N1CC[C@H](c3ccccc3)C1)CC2 |
| InChI | InChI=1S/C20H26N2O3/c23-18(21-25)17-12-20(9-10-20)8-6-16(17)19(24)22-11-7-15(13-22)14-4-2-1-3-5-14/h1-5,15-17,25H,6-13H2,(H,21,23)/t15-,16-,17?/m0/s1 |
| InChIKey | KGFYMTHGZVZNMX-PYNWJHIZSA-N |
| XLogP | 2.70 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|